CAS:2404-87-7|3-Phenylthiophene
Molecular Formula:C10H8S
Molecular Weight:160.24 g/mol
Purity:98 percent
Package:100g/250g/500g/1kg/bulk package
- Világszerte kiszállítás
- Minőségbiztosítás
- 24 órás ügyfélszolgálat
A termék bemutatása
3-Phenylthiophene (3PT) is a heterocyclic aromatic compound containing both sulfur and carbon atoms. It is considered to be a valuable synthetic intermediate for the preparation of a variety of organic compounds. 3PT is used in the synthesis of drugs, dyes, and other organic compounds, and has been studied extensively for its biological activity.
|
|
|
| 3-phenylthiophene | |
| MFCD00114997 | |
| 1.111 g/cm3 | |
| 228.5ºC at 760 mmHg | |
| 90-93ºC | |
| 65.5ºC | |
| 1.598 | |
| 0.11mmHg at 25 degree | |
| InChI=1S/C10H8S/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8H | |
| ZDQZVKVIYAPRON-UHFFFAOYSA-N |
Népszerű tags: cas:2404-87-7|3-phenylthiophene, price, quotation, discount, in stock, for sale
