CAS:5336-90-3|9-Acridinecarboxylic Acid
Molecular Formula:C14H9NO2
Molecular Weight:223.23g/mol
Purity:97 percent
Package:5g/10g/25g/50g/bulk package
- Világszerte kiszállítás
- Minőségbiztosítás
- 24 órás ügyfélszolgálat
A termék bemutatása
9-Acridinecarboxylic Acid(CAS:5336-90-3) is used in the synthesis of short DNA-binding peptides. Useful the preparation of a-amylase, a-glucosidase inhibition, kinetics, SAR cytotoxicity, antitumor activity and docking of ((benzyltriazolyl)methyl)acridine carboxamides.
|
|
|
| acridine-9-carboxylic acid | |
| MFCD00009734 | |
| 480.4 degree C at 760 mmHg (Predicted) | |
| 290 degree | |
| 244.3±21.2 degree | |
| 1.4 g/cm3 | |
| 50.19 | |
| 3.08 | |
| Yellow-green solid | |
| {{0}}.0±1.3 mmHg at 25 degree | |
| 1.756 | |
| InChI=1S/C14H9NO2/c16-14(17)13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17) | |
| IYRYQBAAHMBIFT-UHFFFAOYSA-N |
Népszerű tags: cas:5336-90-3|9-acridinecarboxylic acid, price, quotation, discount, in stock, for sale
